C19H27N3O2 — CID 135871444
methyl (4R,5S,6R)-2-(cyclopropylmethylimino)-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate (PubChem CID 135871444) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl (4R,5S,6R)-2-(cyclopropylmethylimino)-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-2-(cyclopropylmethylimino)-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135871444 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | methyl (4R,5S,6R)-2-(cyclopropylmethylimino)-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CC2CC2)N[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C19H27N3O2/c1-4-22-13(2)16(18(23)24-3)17(15-8-6-5-7-9-15)21-19(22)20-12-14-10-11-14/h5-9,13-14,16-17H,4,10-12H2,1-3H3,(H,20,21)/t13-,16-,17+/m1/s1 |
| InChIKey | FLNLISQVOMAAGW-XYPHTWIQSA-N |
| XLogP | 2.60 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|