C18H27N3O3 — CID 135871454
methyl (4R,5S,6R)-1-ethyl-2-(2-methoxyethylimino)-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate (PubChem CID 135871454) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl (4R,5S,6R)-1-ethyl-2-(2-methoxyethylimino)-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-1-ethyl-2-(2-methoxyethylimino)-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135871454 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | methyl (4R,5S,6R)-1-ethyl-2-(2-methoxyethylimino)-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCOC)N[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C18H27N3O3/c1-5-21-13(2)15(17(22)24-4)16(14-9-7-6-8-10-14)20-18(21)19-11-12-23-3/h6-10,13,15-16H,5,11-12H2,1-4H3,(H,19,20)/t13-,15-,16+/m1/s1 |
| InChIKey | XABZTVRZBZFTFX-BMFZPTHFSA-N |
| XLogP | 1.83 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|