C23H28BrN3O2 — CID 135871464
methyl (4R,5S,6R)-2-[2-(4-bromophenyl)ethylimino]-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate (PubChem CID 135871464) has the molecular formula C23H28BrN3O2 and a molecular weight of 458.40 g/mol. Its IUPAC name is methyl (4R,5S,6R)-2-[2-(4-bromophenyl)ethylimino]-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-2-[2-(4-bromophenyl)ethylimino]-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135871464 |
| Molecular Formula | C23H28BrN3O2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | methyl (4R,5S,6R)-2-[2-(4-bromophenyl)ethylimino]-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCc2ccc(Br)cc2)N[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C23H28BrN3O2/c1-4-27-16(2)20(22(28)29-3)21(18-8-6-5-7-9-18)26-23(27)25-15-14-17-10-12-19(24)13-11-17/h5-13,16,20-21H,4,14-15H2,1-3H3,(H,25,26)/t16-,20-,21+/m1/s1 |
| InChIKey | VDJYKOOKOFMGBN-HBGVWJBISA-N |
| XLogP | 4.19 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|