C15H12ClFN4O2 — CID 135872460
3-[3-(3-chloro-4-fluorophenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-prop-2-ynylpropanamide (PubChem CID 135872460) has the molecular formula C15H12ClFN4O2 and a molecular weight of 334.74 g/mol. Its IUPAC name is 3-[3-(3-chloro-4-fluorophenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-prop-2-ynylpropanamide.
| Compound Name | 3-[3-(3-chloro-4-fluorophenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 135872460 |
| Molecular Formula | C15H12ClFN4O2 |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-[3-(3-chloro-4-fluorophenyl)-5-oxo-4H-1,2,4-triazin-6-yl]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)CCc1nnc(-c2ccc(F)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C15H12ClFN4O2/c1-2-7-18-13(22)6-5-12-15(23)19-14(21-20-12)9-3-4-11(17)10(16)8-9/h1,3-4,8H,5-7H2,(H,18,22)(H,19,21,23) |
| InChIKey | VVKYVYUZQJCVGG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|