C17H12N4O2 — CID 135872932
3-benzyl-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione (PubChem CID 135872932) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-benzyl-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione.
| Compound Name | 3-benzyl-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione |
|---|---|
| PubChem CID | 135872932 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-benzyl-7H-[1,2,4]triazino[4,3-c]quinazoline-4,6-dione |
| SMILES | O=c1[nH]c2ccccc2c2nnc(Cc3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C17H12N4O2/c22-16-14(10-11-6-2-1-3-7-11)19-20-15-12-8-4-5-9-13(12)18-17(23)21(15)16/h1-9H,10H2,(H,18,23) |
| InChIKey | QZMYJDTVTKWNOF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|