C18H21N3O4S — CID 135872935
(4E)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-imino-1-(2-methoxyethyl)pyrrolidin-2-one (PubChem CID 135872935) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is (4E)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-imino-1-(2-methoxyethyl)pyrrolidin-2-one.
| Compound Name | (4E)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-imino-1-(2-methoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 135872935 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (4E)-4-[4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-ylidene]-5-imino-1-(2-methoxyethyl)pyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2\NC(c3ccc(OC)c(OC)c3)=CS2)/CC(=O)N/1CCOC |
| InChI | InChI=1S/C18H21N3O4S/c1-23-7-6-21-16(22)9-12(17(21)19)18-20-13(10-26-18)11-4-5-14(24-2)15(8-11)25-3/h4-5,8,10,19-20H,6-7,9H2,1-3H3/b18-12+,19-17- |
| InChIKey | CXCORJLXPDPENG-LFQOXGNUSA-N |
| XLogP | 2.41 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|