C14H15N3O2 — CID 135873142
3-cyclohex-2-en-1-yl-2-hydroxy-8-methylpyrimido[1,2-a]pyrimidin-4-one (PubChem CID 135873142) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-2-hydroxy-8-methylpyrimido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-cyclohex-2-en-1-yl-2-hydroxy-8-methylpyrimido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135873142 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-2-hydroxy-8-methylpyrimido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccn2c(=O)c(C3C=CCCC3)c(O)nc2n1 |
| InChI | InChI=1S/C14H15N3O2/c1-9-7-8-17-13(19)11(10-5-3-2-4-6-10)12(18)16-14(17)15-9/h3,5,7-8,10,18H,2,4,6H2,1H3 |
| InChIKey | HFFDCEGIZWMFHJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|