C20H23N3O3S — CID 135873987
1-butyl-3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]thiourea (PubChem CID 135873987) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-butyl-3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]thiourea.
| Compound Name | 1-butyl-3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 135873987 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-butyl-3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]thiourea |
| SMILES | CCCCNC(=S)N/N=C1\CC(c2ccc(O)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C20H23N3O3S/c1-2-3-10-21-20(27)23-22-17-12-18(13-4-6-14(24)7-5-13)26-19-11-15(25)8-9-16(17)19/h4-9,11,18,24-25H,2-3,10,12H2,1H3,(H2,21,23,27)/b22-17+ |
| InChIKey | QRBDGLLOLKMKAN-OQKWZONESA-N |
| XLogP | 3.59 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|