C22H27N3O3S — CID 135873989
3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]-1,1-dipropylthiourea (PubChem CID 135873989) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]-1,1-dipropylthiourea.
| Compound Name | 3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]-1,1-dipropylthiourea |
|---|---|
| PubChem CID | 135873989 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-[(E)-[7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-ylidene]amino]-1,1-dipropylthiourea |
| SMILES | CCCN(CCC)C(=S)N/N=C1\CC(c2ccc(O)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H27N3O3S/c1-3-11-25(12-4-2)22(29)24-23-19-14-20(15-5-7-16(26)8-6-15)28-21-13-17(27)9-10-18(19)21/h5-10,13,20,26-27H,3-4,11-12,14H2,1-2H3,(H,24,29)/b23-19+ |
| InChIKey | DQKHFJSTHXWONH-FCDQGJHFSA-N |
| XLogP | 4.32 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|