C20H13ClN4O3 — CID 135874270
4-chloro-2-[(6R)-5,6-dihydrobenzimidazolo[1,2-c]quinazolin-6-yl]-6-nitrophenol (PubChem CID 135874270) has the molecular formula C20H13ClN4O3 and a molecular weight of 392.80 g/mol. Its IUPAC name is 4-chloro-2-[(6R)-5,6-dihydrobenzimidazolo[1,2-c]quinazolin-6-yl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[(6R)-5,6-dihydrobenzimidazolo[1,2-c]quinazolin-6-yl]-6-nitrophenol |
|---|---|
| PubChem CID | 135874270 |
| Molecular Formula | C20H13ClN4O3 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-chloro-2-[(6R)-5,6-dihydrobenzimidazolo[1,2-c]quinazolin-6-yl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cl)cc([C@@H]2Nc3ccccc3-c3nc4ccccc4n32)c1O |
| InChI | InChI=1S/C20H13ClN4O3/c21-11-9-13(18(26)17(10-11)25(27)28)20-22-14-6-2-1-5-12(14)19-23-15-7-3-4-8-16(15)24(19)20/h1-10,20,22,26H/t20-/m1/s1 |
| InChIKey | GSDFGRKPOLEWNG-HXUWFJFHSA-N |
| XLogP | 4.94 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|