C34H40N2O2 — CID 135874439
2-[[(1R,2R)-1,2-bis[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol (PubChem CID 135874439) has the molecular formula C34H40N2O2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 2-[[(1R,2R)-1,2-bis[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol.
| Compound Name | 2-[[(1R,2R)-1,2-bis[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135874439 |
| Molecular Formula | C34H40N2O2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 2-[[(1R,2R)-1,2-bis[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2-[(2-hydroxyphenyl)methylideneamino]ethyl]iminomethyl]phenol |
| SMILES | CC1(C)[C@H]2CC=C([C@@H](/N=C/c3ccccc3O)[C@H](/N=C/c3ccccc3O)C3=CC[C@H]4C[C@@H]3C4(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C34H40N2O2/c1-33(2)23-13-15-25(27(33)17-23)31(35-19-21-9-5-7-11-29(21)37)32(36-20-22-10-6-8-12-30(22)38)26-16-14-24-18-28(26)34(24,3)4/h5-12,15-16,19-20,23-24,27-28,31-32,37-38H,13-14,17-18H2,1-4H3/b35-19+,36-20+/t23-,24-,27-,28-,31+,32+/m0/s1 |
| InChIKey | QFVPKIORQYECGH-FOOJPNEJSA-N |
| XLogP | 7.36 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|