C64H60CuN6O12 — CID 135874456
copper bis((1E,3Z,6E)-5-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,3,6-trien-3-olate) (PubChem CID 135874456) has the molecular formula C64H60CuN6O12 and a molecular weight of 1168.76 g/mol. Its IUPAC name is copper bis((1E,3Z,6E)-5-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,3,6-trien-3-olate).
| Compound Name | copper bis((1E,3Z,6E)-5-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,3,6-trien-3-olate) |
|---|---|
| PubChem CID | 135874456 |
| Molecular Formula | C64H60CuN6O12 |
| Molecular Weight | 1168.76 g/mol |
| Exact Mass | 1167.36 |
| IUPAC Name | copper bis((1E,3Z,6E)-5-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,3,6-trien-3-olate) |
| SMILES | COc1cc(/C=C/C([O-])=C/C(/C=C/c2ccc(O)c(OC)c2)=N/c2c(C)n(C)n(-c3ccccc3)c2=O)ccc1O.COc1cc(/C=C/C([O-])=C/C(/C=C/c2ccc(O)c(OC)c2)=N\c2c(C)n(C)n(-c3ccccc3)c2=O)ccc1O.[Cu+2] |
| InChI | InChI=1S/2C32H31N3O6.Cu/c2*1-21-31(32(39)35(34(21)2)25-8-6-5-7-9-25)33-24(14-10-22-12-16-27(37)29(18-22)40-3)20-26(36)15-11-23-13-17-28(38)30(19-23)41-4;/h2*5-20,36-38H,1-4H3;/q;;+2/p-2/b14-10+,15-11+,26-20-,33-24+;14-10+,15-11+,26-20-,33-24-; |
| InChIKey | MIJSDKHJCFXFMU-UXMXHKOXSA-L |
| XLogP | 9.31 |
| TPSA | 242.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|