About 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one
2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one (PubChem CID 135874482) has the molecular formula C17H16F3N5O2
and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one |
| PubChem CID | 135874482 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(N2CCC(Oc3ccccc3C(F)(F)F)CC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C17H16F3N5O2/c18-17(19,20)11-3-1-2-4-12(11)27-10-5-7-25(8-6-10)16-23-14-13(15(26)24-16)21-9-22-14/h1-4,9-10H,5-8H2,(H2,21,22,23,24,26) |
| InChIKey | WIASLCVAGCLOBE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one?
The IUPAC name of 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one (CID 135874482) is 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one?
The canonical SMILES for 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one is O=c1[nH]c(N2CCC(Oc3ccccc3C(F)(F)F)CC2)nc2nc[nH]c12.
What is the InChIKey of 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one?
The InChIKey is WIASLCVAGCLOBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3N5O2/c18-17(19,20)11-3-1-2-4-12(11)27-10-5-7-25(8-6-10)16-23-14-13(15(26)24-16)21-9-22-14/h1-4,9-10H,5-8H2,(H2,21,22,23,24,26).
What are the key properties of 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one?
2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one has a molecular weight of 379.34 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,7-dihydropurin-6-one is sourced from PubChem (CID 135874482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).