C13H21N5O — CID 135875004
(3R,5R)-3,5-dimethyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide (PubChem CID 135875004) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide.
| Compound Name | (3R,5R)-3,5-dimethyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 135875004 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-N'-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-1-carboximidamide |
| SMILES | Cc1cc(=O)[nH]c(N=C(N)N2C[C@H](C)C[C@@H](C)C2)n1 |
| InChI | InChI=1S/C13H21N5O/c1-8-4-9(2)7-18(6-8)12(14)17-13-15-10(3)5-11(19)16-13/h5,8-9H,4,6-7H2,1-3H3,(H3,14,15,16,17,19)/t8-,9-/m1/s1 |
| InChIKey | GNZMVRUSFAZOCX-RKDXNWHRSA-N |
| XLogP | 1.00 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|