C26H31FN4O — CID 135875803
8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135875803) has the molecular formula C26H31FN4O and a molecular weight of 434.56 g/mol. Its IUPAC name is 8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135875803 |
| Molecular Formula | C26H31FN4O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 8-benzyl-4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCN(Cc3ccccc3)CC2)N1c1cccc(F)c1 |
| InChI | InChI=1S/C26H31FN4O/c27-21-10-7-13-23(18-21)31-25(32)29-24(28-22-11-5-2-6-12-22)26(31)14-16-30(17-15-26)19-20-8-3-1-4-9-20/h1,3-4,7-10,13,18,22H,2,5-6,11-12,14-17,19H2,(H,28,29,32) |
| InChIKey | PLPAEWRELXZNRK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|