C28H35N5O2 — CID 135875804
N-[4-(8-benzyl-4-cyclohexylimino-2-oxo-1,3,8-triazaspiro[4.5]decan-1-yl)phenyl]acetamide (PubChem CID 135875804) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[4-(8-benzyl-4-cyclohexylimino-2-oxo-1,3,8-triazaspiro[4.5]decan-1-yl)phenyl]acetamide.
| Compound Name | N-[4-(8-benzyl-4-cyclohexylimino-2-oxo-1,3,8-triazaspiro[4.5]decan-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135875804 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-[4-(8-benzyl-4-cyclohexylimino-2-oxo-1,3,8-triazaspiro[4.5]decan-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)N/C(=N\C3CCCCC3)C23CCN(Cc2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C28H35N5O2/c1-21(34)29-24-12-14-25(15-13-24)33-27(35)31-26(30-23-10-6-3-7-11-23)28(33)16-18-32(19-17-28)20-22-8-4-2-5-9-22/h2,4-5,8-9,12-15,23H,3,6-7,10-11,16-20H2,1H3,(H,29,34)(H,30,31,35) |
| InChIKey | FPDCVNHEKYJTLH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|