C19H25FN4O — CID 135875805
4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135875805) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135875805 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-cyclohexylimino-1-(3-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCNCC2)N1c1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN4O/c20-14-5-4-8-16(13-14)24-18(25)23-17(19(24)9-11-21-12-10-19)22-15-6-2-1-3-7-15/h4-5,8,13,15,21H,1-3,6-7,9-12H2,(H,22,23,25) |
| InChIKey | CLSHIGIZZCVNHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|