C33H37FN4O — CID 135875808
4-cyclohexylimino-1-(3-fluorophenyl)-8-[[3-(2-methylphenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135875808) has the molecular formula C33H37FN4O and a molecular weight of 524.68 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3-fluorophenyl)-8-[[3-(2-methylphenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-[[3-(2-methylphenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135875808 |
| Molecular Formula | C33H37FN4O |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-[[3-(2-methylphenyl)phenyl]methyl]-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | Cc1ccccc1-c1cccc(CN2CCC3(CC2)/C(=N/C2CCCCC2)NC(=O)N3c2cccc(F)c2)c1 |
| InChI | InChI=1S/C33H37FN4O/c1-24-9-5-6-16-30(24)26-11-7-10-25(21-26)23-37-19-17-33(18-20-37)31(35-28-13-3-2-4-14-28)36-32(39)38(33)29-15-8-12-27(34)22-29/h5-12,15-16,21-22,28H,2-4,13-14,17-20,23H2,1H3,(H,35,36,39) |
| InChIKey | QQZNFBADZFMIHT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|