C27H34N4O — CID 135875883
1,8-dibenzyl-4-cyclohexylimino-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135875883) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is 1,8-dibenzyl-4-cyclohexylimino-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1,8-dibenzyl-4-cyclohexylimino-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135875883 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 1,8-dibenzyl-4-cyclohexylimino-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCN(Cc3ccccc3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H34N4O/c32-26-29-25(28-24-14-8-3-9-15-24)27(31(26)21-23-12-6-2-7-13-23)16-18-30(19-17-27)20-22-10-4-1-5-11-22/h1-2,4-7,10-13,24H,3,8-9,14-21H2,(H,28,29,32) |
| InChIKey | WYOZUUUAVPMXIT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|