C25H28F2N4O — CID 135875884
4-cyclohexylimino-1-(3-fluorophenyl)-8-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135875884) has the molecular formula C25H28F2N4O and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3-fluorophenyl)-8-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135875884 |
| Molecular Formula | C25H28F2N4O |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-cyclohexylimino-1-(3-fluorophenyl)-8-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCN(c3ccc(F)cc3)CC2)N1c1cccc(F)c1 |
| InChI | InChI=1S/C25H28F2N4O/c26-18-9-11-21(12-10-18)30-15-13-25(14-16-30)23(28-20-6-2-1-3-7-20)29-24(32)31(25)22-8-4-5-19(27)17-22/h4-5,8-12,17,20H,1-3,6-7,13-16H2,(H,28,29,32) |
| InChIKey | ZWOBSDHHHCJSBJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|