About 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole
6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole (PubChem CID 135875998) has the molecular formula C20H18N6
and a molecular weight of 342.41 g/mol. Its IUPAC name is 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole.
Molecular Properties
| Compound Name | 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole |
| PubChem CID | 135875998 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole |
| SMILES | Cc1ccc(Cn2nc(-c3nc4cc5c[nH][nH]c5cc4n3)cc2C)cc1 |
| InChI | InChI=1S/C20H18N6/c1-12-3-5-14(6-4-12)11-26-13(2)7-19(25-26)20-22-17-8-15-10-21-24-16(15)9-18(17)23-20/h3-10,21,24H,11H2,1-2H3 |
| InChIKey | RTYDVOJTNYHBKL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole?
The IUPAC name of 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole (CID 135875998) is 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole.
What is the SMILES notation for 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole?
The canonical SMILES for 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole is Cc1ccc(Cn2nc(-c3nc4cc5c[nH][nH]c5cc4n3)cc2C)cc1.
What is the InChIKey of 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole?
The InChIKey is RTYDVOJTNYHBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N6/c1-12-3-5-14(6-4-12)11-26-13(2)7-19(25-26)20-22-17-8-15-10-21-24-16(15)9-18(17)23-20/h3-10,21,24H,11H2,1-2H3.
What are the key properties of 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole?
6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole has a molecular weight of 342.41 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1,2-dihydroimidazo[4,5-f]indazole is sourced from PubChem (CID 135875998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).