C12H11N5OS — CID 135876316
2-(5-amino-3-thiophen-2-ylpyrazol-1-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 135876316) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-(5-amino-3-thiophen-2-ylpyrazol-1-yl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(5-amino-3-thiophen-2-ylpyrazol-1-yl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135876316 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(5-amino-3-thiophen-2-ylpyrazol-1-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(-n2nc(-c3cccs3)cc2N)n1 |
| InChI | InChI=1S/C12H11N5OS/c1-7-5-11(18)15-12(14-7)17-10(13)6-8(16-17)9-3-2-4-19-9/h2-6H,13H2,1H3,(H,14,15,18) |
| InChIKey | JCEFPTUTBIWPQN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |