C14H12N4OS — CID 135876353
2-(5-aminoquinolin-8-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 135876353) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(5-aminoquinolin-8-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(5-aminoquinolin-8-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135876353 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(5-aminoquinolin-8-yl)sulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc(N)c3cccnc23)n1 |
| InChI | InChI=1S/C14H12N4OS/c1-8-7-12(19)18-14(17-8)20-11-5-4-10(15)9-3-2-6-16-13(9)11/h2-7H,15H2,1H3,(H,17,18,19) |
| InChIKey | BVZPKJWEMNLFOY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|