C21H24N4O4S — CID 135877243
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 135877243) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 135877243 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCc2nc3ccccc3c(=O)[nH]2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H24N4O4S/c1-14-11-12-15(13-18(14)30(28,29)25(2)3)22-20(26)10-6-9-19-23-17-8-5-4-7-16(17)21(27)24-19/h4-5,7-8,11-13H,6,9-10H2,1-3H3,(H,22,26)(H,23,24,27) |
| InChIKey | INFYCNDJSYAGBZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |