C21H21N3O6S — CID 135877917
[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135877917) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135877917 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)OC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O6S/c1-13(25)15-7-3-5-9-17(15)23-21(27)14(2)30-19(26)11-12-22-20-16-8-4-6-10-18(16)31(28,29)24-20/h3-10,14H,11-12H2,1-2H3,(H,22,24)(H,23,27)/t14-/m1/s1 |
| InChIKey | RVWOMTDPRBKNKK-CQSZACIVSA-N |
| XLogP | 1.89 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|