About ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate
ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate (PubChem CID 135878420) has the molecular formula C15H14N4O2S
and a molecular weight of 314.37 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 135878420 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N/N=C/c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C15H14N4O2S/c1-2-21-14(20)13-9-22-15(18-13)19-17-8-10-7-16-12-6-4-3-5-11(10)12/h3-9,16H,2H2,1H3,(H,18,19)/b17-8+ |
| InChIKey | XWJJSTNVVYIAGG-CAOOACKPSA-N |
| XLogP | 3.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate (CID 135878420) is ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(N/N=C/c2c[nH]c3ccccc23)n1.
What is the InChIKey of ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate?
The InChIKey is XWJJSTNVVYIAGG-CAOOACKPSA-N. The full InChI is InChI=1S/C15H14N4O2S/c1-2-21-14(20)13-9-22-15(18-13)19-17-8-10-7-16-12-6-4-3-5-11(10)12/h3-9,16H,2H2,1H3,(H,18,19)/b17-8+.
What are the key properties of ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate has a molecular weight of 314.37 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 135878420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).