C21H15ClFN5O2 — CID 135878454
3-(2-chlorophenyl)-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 135878454) has the molecular formula C21H15ClFN5O2 and a molecular weight of 423.84 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135878454 |
| Molecular Formula | C21H15ClFN5O2 |
| Molecular Weight | 423.84 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)N/N=C\c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15ClFN5O2/c1-12-18(20(28-30-12)16-4-2-3-5-17(16)22)21(29)27-25-11-14-10-24-26-19(14)13-6-8-15(23)9-7-13/h2-11H,1H3,(H,24,26)(H,27,29)/b25-11- |
| InChIKey | BOQVLSFDIVNWEK-GATIEOLUSA-N |
| XLogP | 4.60 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|