C27H35N5O8 — CID 135879970
[5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 135879970) has the molecular formula C27H35N5O8 and a molecular weight of 557.60 g/mol. Its IUPAC name is [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 135879970 |
| Molecular Formula | C27H35N5O8 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC1OC(n2cc3c(N)cc(=O)nc4c3c2N=CN4)C(C)(OC(=O)C(C)C)C1OC(=O)C(C)C |
| InChI | InChI=1S/C27H35N5O8/c1-12(2)23(34)37-10-17-20(39-24(35)13(3)4)27(7,40-25(36)14(5)6)26(38-17)32-9-15-16(28)8-18(33)31-21-19(15)22(32)30-11-29-21/h8-9,11-14,17,20,26H,10,28H2,1-7H3,(H,29,30,31,33) |
| InChIKey | FCOJMHCPPXOQOT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 173.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|