About (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one
(3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one (PubChem CID 135881263) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one |
| PubChem CID | 135881263 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one |
| SMILES | Cc1cc(C)c2c(c1)/C(=N\N1CCN(C)CC1)C(=O)N2 |
| InChI | InChI=1S/C15H20N4O/c1-10-8-11(2)13-12(9-10)14(15(20)16-13)17-19-6-4-18(3)5-7-19/h8-9H,4-7H2,1-3H3,(H,16,17,20) |
| InChIKey | KEYIWARGYAXHFK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one?
The IUPAC name of (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one (CID 135881263) is (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one.
What is the SMILES notation for (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one?
The canonical SMILES for (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one is Cc1cc(C)c2c(c1)/C(=N\N1CCN(C)CC1)C(=O)N2.
What is the InChIKey of (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one?
The InChIKey is KEYIWARGYAXHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-10-8-11(2)13-12(9-10)14(15(20)16-13)17-19-6-4-18(3)5-7-19/h8-9H,4-7H2,1-3H3,(H,16,17,20).
What are the key properties of (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one?
(3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one has a molecular weight of 272.35 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5,7-dimethyl-3-(4-methylpiperazin-1-yl)imino-1H-indol-2-one is sourced from PubChem (CID 135881263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).