C19H18O7 — CID 135881392
[(2R,3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)oxiran-2-yl]-[2-hydroxy-5-(methoxymethoxy)phenyl]methanone (PubChem CID 135881392) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is [(2R,3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)oxiran-2-yl]-[2-hydroxy-5-(methoxymethoxy)phenyl]methanone.
| Compound Name | [(2R,3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)oxiran-2-yl]-[2-hydroxy-5-(methoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 135881392 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [(2R,3R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)oxiran-2-yl]-[2-hydroxy-5-(methoxymethoxy)phenyl]methanone |
| SMILES | COCOc1ccc(O)c(C(=O)[C@@H]2O[C@@H]2c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C19H18O7/c1-22-10-25-12-3-4-14(20)13(9-12)17(21)19-18(26-19)11-2-5-15-16(8-11)24-7-6-23-15/h2-5,8-9,18-20H,6-7,10H2,1H3/t18-,19+/m1/s1 |
| InChIKey | AKPJNFLPPDDSFI-MOPGFXCFSA-N |
| XLogP | 2.47 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|