C22H23N3O2 — CID 135881485
N-[1-(cyclohexylmethyl)-2-hydroxyindol-3-yl]iminobenzamide (PubChem CID 135881485) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[1-(cyclohexylmethyl)-2-hydroxyindol-3-yl]iminobenzamide.
| Compound Name | N-[1-(cyclohexylmethyl)-2-hydroxyindol-3-yl]iminobenzamide |
|---|---|
| PubChem CID | 135881485 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[1-(cyclohexylmethyl)-2-hydroxyindol-3-yl]iminobenzamide |
| SMILES | O=C(/N=N/c1c(O)n(CC2CCCCC2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c26-21(17-11-5-2-6-12-17)24-23-20-18-13-7-8-14-19(18)25(22(20)27)15-16-9-3-1-4-10-16/h2,5-8,11-14,16,27H,1,3-4,9-10,15H2/b24-23+ |
| InChIKey | UTCMVXRMYYFCMH-WCWDXBQESA-N |
| XLogP | 5.85 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|