About 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide
5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide (PubChem CID 135881796) has the molecular formula C11H11IN2S
and a molecular weight of 330.19 g/mol. Its IUPAC name is 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide.
Molecular Properties
| Compound Name | 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide |
| PubChem CID | 135881796 |
| Molecular Formula | C11H11IN2S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide |
| SMILES | Cc1cccc2c1Cc1sc(N)[nH+]c1-2.[I-] |
| InChI | InChI=1S/C11H10N2S.HI/c1-6-3-2-4-7-8(6)5-9-10(7)13-11(12)14-9;/h2-4H,5H2,1H3,(H2,12,13);1H |
| InChIKey | ZWVANVQGVPVJPM-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide?
The IUPAC name of 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide (CID 135881796) is 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide.
What is the SMILES notation for 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide?
The canonical SMILES for 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide is Cc1cccc2c1Cc1sc(N)[nH+]c1-2.[I-].
What is the InChIKey of 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide?
The InChIKey is ZWVANVQGVPVJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S.HI/c1-6-3-2-4-7-8(6)5-9-10(7)13-11(12)14-9;/h2-4H,5H2,1H3,(H2,12,13);1H.
What are the key properties of 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide?
5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide has a molecular weight of 330.19 g/mol, XLogP of -0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide is sourced from PubChem (CID 135881796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).