C16H18N4OS — CID 135881923
2-[(1R)-1-(1-propylimidazol-2-yl)sulfanylethyl]-3H-quinazolin-4-one (PubChem CID 135881923) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[(1R)-1-(1-propylimidazol-2-yl)sulfanylethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-(1-propylimidazol-2-yl)sulfanylethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135881923 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[(1R)-1-(1-propylimidazol-2-yl)sulfanylethyl]-3H-quinazolin-4-one |
| SMILES | CCCn1ccnc1S[C@H](C)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N4OS/c1-3-9-20-10-8-17-16(20)22-11(2)14-18-13-7-5-4-6-12(13)15(21)19-14/h4-8,10-11H,3,9H2,1-2H3,(H,18,19,21)/t11-/m1/s1 |
| InChIKey | AEYXZEJXOFDLQJ-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |