About 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene
3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene (PubChem CID 135883270) has the molecular formula C21H18ClF2N3O
and a molecular weight of 401.84 g/mol. Its IUPAC name is 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene.
Molecular Properties
| Compound Name | 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene |
| PubChem CID | 135883270 |
| Molecular Formula | C21H18ClF2N3O |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene |
| SMILES | Fc1cccc(F)c1-c1cc(Cl)c2nc(C3=NOC4(CCCCC4)C3)[nH]c2c1 |
| InChI | InChI=1S/C21H18ClF2N3O/c22-13-9-12(18-14(23)5-4-6-15(18)24)10-16-19(13)26-20(25-16)17-11-21(28-27-17)7-2-1-3-8-21/h4-6,9-10H,1-3,7-8,11H2,(H,25,26) |
| InChIKey | MVYLLDYNCCEEPV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene?
The IUPAC name of 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene (CID 135883270) is 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene.
What is the SMILES notation for 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene?
The canonical SMILES for 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene is Fc1cccc(F)c1-c1cc(Cl)c2nc(C3=NOC4(CCCCC4)C3)[nH]c2c1.
What is the InChIKey of 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene?
The InChIKey is MVYLLDYNCCEEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClF2N3O/c22-13-9-12(18-14(23)5-4-6-15(18)24)10-16-19(13)26-20(25-16)17-11-21(28-27-17)7-2-1-3-8-21/h4-6,9-10H,1-3,7-8,11H2,(H,25,26).
What are the key properties of 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene?
3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene has a molecular weight of 401.84 g/mol, XLogP of 5.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-chloro-6-(2,6-difluorophenyl)-1H-benzimidazol-2-yl]-1-oxa-2-azaspiro[4.5]dec-2-ene is sourced from PubChem (CID 135883270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).