C25H22N8O8 — CID 135883342
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(4-nitrophenoxy)-5-oxopentanoic acid (PubChem CID 135883342) has the molecular formula C25H22N8O8 and a molecular weight of 562.50 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(4-nitrophenoxy)-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(4-nitrophenoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135883342 |
| Molecular Formula | C25H22N8O8 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(4-nitrophenoxy)-5-oxopentanoic acid |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)Oc4ccc([N+](=O)[O-])cc4)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H22N8O8/c26-25-31-21-20(23(36)32-25)29-15(12-28-21)11-27-14-3-1-13(2-4-14)22(35)30-18(24(37)38)9-10-19(34)41-17-7-5-16(6-8-17)33(39)40/h1-8,12,18,27H,9-11H2,(H,30,35)(H,37,38)(H3,26,28,31,32,36)/t18-/m0/s1 |
| InChIKey | BOSJYTLSCVSICF-SFHVURJKSA-N |
| XLogP | 1.38 |
| TPSA | 245.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|