C19H13N3O3 — CID 135884662
6-hydroxy-5-[(Z)-(2-phenylindol-3-ylidene)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 135884662) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 6-hydroxy-5-[(Z)-(2-phenylindol-3-ylidene)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(Z)-(2-phenylindol-3-ylidene)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135884662 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 6-hydroxy-5-[(Z)-(2-phenylindol-3-ylidene)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/C=C2\C(c3ccccc3)=Nc3ccccc32)c(=O)[nH]1 |
| InChI | InChI=1S/C19H13N3O3/c23-17-14(18(24)22-19(25)21-17)10-13-12-8-4-5-9-15(12)20-16(13)11-6-2-1-3-7-11/h1-10H,(H3,21,22,23,24,25)/b13-10- |
| InChIKey | KBJKNOWFQVLAIL-RAXLEYEMSA-N |
| XLogP | 2.44 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |