C15H12ClN5O2 — CID 135885787
5-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-3-chlorobenzene-1,2-diol (PubChem CID 135885787) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 5-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-3-chlorobenzene-1,2-diol.
| Compound Name | 5-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-3-chlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 135885787 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-(2-amino-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-4-yl)-3-chlorobenzene-1,2-diol |
| SMILES | NC1=NC(c2cc(O)c(O)c(Cl)c2)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-8-5-7(6-11(22)12(8)23)13-19-14(17)20-15-18-9-3-1-2-4-10(9)21(13)15/h1-6,13,22-23H,(H3,17,18,19,20) |
| InChIKey | DZQFPRGMSDXFTN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|