C19H22N4O4 — CID 135886227
(5S)-5-(2,4-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135886227) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is (5S)-5-(2,4-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | (5S)-5-(2,4-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135886227 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (5S)-5-(2,4-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | COc1ccc([C@@H]2Nc3nonc3NC3=C2C(=O)CC(C)(C)C3)c(OC)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-19(2)8-12-15(13(24)9-19)16(21-18-17(20-12)22-27-23-18)11-6-5-10(25-3)7-14(11)26-4/h5-7,16H,8-9H2,1-4H3,(H,20,22)(H,21,23)/t16-/m0/s1 |
| InChIKey | RXZXPVCPUBUITH-INIZCTEOSA-N |
| XLogP | 3.31 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |