C8H13N6O+ — CID 135886615
2-amino-6-(aminomethyl)-5-methylidene-3,6,7,8-tetrahydropteridin-5-ium-4-one (PubChem CID 135886615) has the molecular formula C8H13N6O+ and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-amino-6-(aminomethyl)-5-methylidene-3,6,7,8-tetrahydropteridin-5-ium-4-one.
| Compound Name | 2-amino-6-(aminomethyl)-5-methylidene-3,6,7,8-tetrahydropteridin-5-ium-4-one |
|---|---|
| PubChem CID | 135886615 |
| Molecular Formula | C8H13N6O+ |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-6-(aminomethyl)-5-methylidene-3,6,7,8-tetrahydropteridin-5-ium-4-one |
| SMILES | C=[N+]1c2c(nc(N)[nH]c2=O)NCC1CN |
| InChI | InChI=1S/C8H12N6O/c1-14-4(2-9)3-11-6-5(14)7(15)13-8(10)12-6/h4H,1-3,9H2,(H3-,10,11,12,13,15)/p+1 |
| InChIKey | SBBRCICYNAOFFG-UHFFFAOYSA-O |
| XLogP | -1.55 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|