About (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one
(2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135886855) has the molecular formula C10H7Cl2N3OS
and a molecular weight of 288.16 g/mol. Its IUPAC name is (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| PubChem CID | 135886855 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=C/c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c11-7-2-1-6(8(12)3-7)4-13-15-10-14-9(16)5-17-10/h1-4H,5H2,(H,14,15,16)/b13-4+ |
| InChIKey | YWZGAZGZNHNMNW-YIXHJXPBSA-N |
| XLogP | 2.55 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (CID 135886855) is (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is O=C1CS/C(=N/N=C/c2ccc(Cl)cc2Cl)N1.
What is the InChIKey of (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
The InChIKey is YWZGAZGZNHNMNW-YIXHJXPBSA-N. The full InChI is InChI=1S/C10H7Cl2N3OS/c11-7-2-1-6(8(12)3-7)4-13-15-10-14-9(16)5-17-10/h1-4H,5H2,(H,14,15,16)/b13-4+.
What are the key properties of (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one?
(2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one has a molecular weight of 288.16 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one is sourced from PubChem (CID 135886855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).