C24H26N4O6S3 — CID 135887233
N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-(thiophen-2-ylmethyl)-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 135887233) has the molecular formula C24H26N4O6S3 and a molecular weight of 562.70 g/mol. Its IUPAC name is N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-(thiophen-2-ylmethyl)-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-(thiophen-2-ylmethyl)-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135887233 |
| Molecular Formula | C24H26N4O6S3 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | N-[3-[(2S,7R)-6-hydroxy-4-oxo-3-(thiophen-2-ylmethyl)-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1=C(O)[C@@H]3C4CCC(CC4)[C@@H]3N(Cc3cccs3)C1=O)N2 |
| InChI | InChI=1S/C24H26N4O6S3/c1-36(31,32)26-15-8-9-17-18(11-15)37(33,34)27-23(25-17)20-22(29)19-13-4-6-14(7-5-13)21(19)28(24(20)30)12-16-3-2-10-35-16/h2-3,8-11,13-14,19,21,26,29H,4-7,12H2,1H3,(H,25,27)/t13?,14?,19-,21+/m1/s1 |
| InChIKey | CALQRYHVGBSXJK-NPWGZZIZSA-N |
| XLogP | 3.29 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |