C25H26N8OS — CID 135887265
4-[4-amino-5-[7-(1,3-thiazol-2-yl)-1H-indol-2-yl]imidazo[5,1-f][1,2,4]triazin-7-yl]-N,N-dimethylcyclohexane-1-carboxamide (PubChem CID 135887265) has the molecular formula C25H26N8OS and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[4-amino-5-[7-(1,3-thiazol-2-yl)-1H-indol-2-yl]imidazo[5,1-f][1,2,4]triazin-7-yl]-N,N-dimethylcyclohexane-1-carboxamide.
| Compound Name | 4-[4-amino-5-[7-(1,3-thiazol-2-yl)-1H-indol-2-yl]imidazo[5,1-f][1,2,4]triazin-7-yl]-N,N-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 135887265 |
| Molecular Formula | C25H26N8OS |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[4-amino-5-[7-(1,3-thiazol-2-yl)-1H-indol-2-yl]imidazo[5,1-f][1,2,4]triazin-7-yl]-N,N-dimethylcyclohexane-1-carboxamide |
| SMILES | CN(C)C(=O)C1CCC(c2nc(-c3cc4cccc(-c5nccs5)c4[nH]3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C25H26N8OS/c1-32(2)25(34)15-8-6-14(7-9-15)23-31-20(21-22(26)28-13-29-33(21)23)18-12-16-4-3-5-17(19(16)30-18)24-27-10-11-35-24/h3-5,10-15,30H,6-9H2,1-2H3,(H2,26,28,29) |
| InChIKey | GEVADTLSJRTWBT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |