C22H21N7O5S — CID 135887427
3-benzyl-5-[(3S)-1-(3-nitrophenyl)sulfonylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135887427) has the molecular formula C22H21N7O5S and a molecular weight of 495.52 g/mol. Its IUPAC name is 3-benzyl-5-[(3S)-1-(3-nitrophenyl)sulfonylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-5-[(3S)-1-(3-nitrophenyl)sulfonylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135887427 |
| Molecular Formula | C22H21N7O5S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 3-benzyl-5-[(3S)-1-(3-nitrophenyl)sulfonylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c([C@H]2CCCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)C2)nc2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C22H21N7O5S/c30-22-19-21(28(26-25-19)13-15-6-2-1-3-7-15)23-20(24-22)16-8-5-11-27(14-16)35(33,34)18-10-4-9-17(12-18)29(31)32/h1-4,6-7,9-10,12,16H,5,8,11,13-14H2,(H,23,24,30)/t16-/m0/s1 |
| InChIKey | RVGGGXSWGCJTKY-INIZCTEOSA-N |
| XLogP | 2.04 |
| TPSA | 156.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|