C16H20N6 — CID 135887665
1-(cyclohex-3-en-1-ylmethyl)-5-(2,5-dimethylpyrazol-3-yl)-4H-imidazo[4,5-d]pyrazole (PubChem CID 135887665) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-5-(2,5-dimethylpyrazol-3-yl)-4H-imidazo[4,5-d]pyrazole.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-5-(2,5-dimethylpyrazol-3-yl)-4H-imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 135887665 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-5-(2,5-dimethylpyrazol-3-yl)-4H-imidazo[4,5-d]pyrazole |
| SMILES | Cc1cc(-c2nc3c(cnn3CC3CC=CCC3)[nH]2)n(C)n1 |
| InChI | InChI=1S/C16H20N6/c1-11-8-14(21(2)20-11)15-18-13-9-17-22(16(13)19-15)10-12-6-4-3-5-7-12/h3-4,8-9,12H,5-7,10H2,1-2H3,(H,18,19) |
| InChIKey | MTZFUSYWXIQNKA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|