C11H6ClN5O4 — CID 135888974
1-(5-chloro-6-nitro-1H-benzimidazol-2-yl)pyrazole-4-carboxylic acid (PubChem CID 135888974) has the molecular formula C11H6ClN5O4 and a molecular weight of 307.65 g/mol. Its IUPAC name is 1-(5-chloro-6-nitro-1H-benzimidazol-2-yl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(5-chloro-6-nitro-1H-benzimidazol-2-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135888974 |
| Molecular Formula | C11H6ClN5O4 |
| Molecular Weight | 307.65 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1-(5-chloro-6-nitro-1H-benzimidazol-2-yl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2nc3cc(Cl)c([N+](=O)[O-])cc3[nH]2)c1 |
| InChI | InChI=1S/C11H6ClN5O4/c12-6-1-7-8(2-9(6)17(20)21)15-11(14-7)16-4-5(3-13-16)10(18)19/h1-4H,(H,14,15)(H,18,19) |
| InChIKey | ZKVZEDDQOJUUNP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|