C19H26N4OS — CID 135889062
5-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135889062) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135889062 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | c1cc2c(cc1C1=NN/C(=N/CCCN3CCOCC3)SC1)CCC2 |
| InChI | InChI=1S/C19H26N4OS/c1-3-15-5-6-17(13-16(15)4-1)18-14-25-19(22-21-18)20-7-2-8-23-9-11-24-12-10-23/h5-6,13H,1-4,7-12,14H2,(H,20,22) |
| InChIKey | ZDFWJXWQSAXFNU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|