C8H8F5NO3 — CID 135889697
methyl (2E)-4,4,5,5,5-pentafluoro-2-(1-hydroxyethylidene)-3-iminopentanoate (PubChem CID 135889697) has the molecular formula C8H8F5NO3 and a molecular weight of 261.15 g/mol. Its IUPAC name is methyl (2E)-4,4,5,5,5-pentafluoro-2-(1-hydroxyethylidene)-3-iminopentanoate.
| Compound Name | methyl (2E)-4,4,5,5,5-pentafluoro-2-(1-hydroxyethylidene)-3-iminopentanoate |
|---|---|
| PubChem CID | 135889697 |
| Molecular Formula | C8H8F5NO3 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | methyl (2E)-4,4,5,5,5-pentafluoro-2-(1-hydroxyethylidene)-3-iminopentanoate |
| SMILES | [H]/N=C(C(\C(=O)OC)=C(\C)O)/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F5NO3/c1-3(15)4(6(16)17-2)5(14)7(9,10)8(11,12)13/h14-15H,1-2H3/b4-3+,14-5+ |
| InChIKey | DRNNOUDFGAFDHW-ORRXZRLISA-N |
| XLogP | 2.21 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|