About 5-azido-1H-1,2,4-triazol-3-amine
5-azido-1H-1,2,4-triazol-3-amine (PubChem CID 135889704) has the molecular formula C2H3N7
and a molecular weight of 125.09 g/mol. Its IUPAC name is 5-azido-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-azido-1H-1,2,4-triazol-3-amine |
| PubChem CID | 135889704 |
| Molecular Formula | C2H3N7 |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.04 |
| IUPAC Name | 5-azido-1H-1,2,4-triazol-3-amine |
| SMILES | [N-]=[N+]=Nc1nc(N)n[nH]1 |
| InChI | InChI=1S/C2H3N7/c3-1-5-2(7-6-1)8-9-4/h(H3,3,5,6,7) |
| InChIKey | FVQJGJOWBMJPNW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-azido-1H-1,2,4-triazol-3-amine (CID 135889704) is 5-azido-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-azido-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-azido-1H-1,2,4-triazol-3-amine is [N-]=[N+]=Nc1nc(N)n[nH]1.
What is the InChIKey of 5-azido-1H-1,2,4-triazol-3-amine?
The InChIKey is FVQJGJOWBMJPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3N7/c3-1-5-2(7-6-1)8-9-4/h(H3,3,5,6,7).
What are the key properties of 5-azido-1H-1,2,4-triazol-3-amine?
5-azido-1H-1,2,4-triazol-3-amine has a molecular weight of 125.09 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 135889704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).