C14H22N4O2 — CID 135889772
(3S)-1-ethyl-3-methyl-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]piperidine-3-carboxamide (PubChem CID 135889772) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is (3S)-1-ethyl-3-methyl-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethyl-3-methyl-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135889772 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3S)-1-ethyl-3-methyl-N-[(6-oxo-1H-pyrimidin-4-yl)methyl]piperidine-3-carboxamide |
| SMILES | CCN1CCC[C@](C)(C(=O)NCc2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-18-6-4-5-14(2,9-18)13(20)15-8-11-7-12(19)17-10-16-11/h7,10H,3-6,8-9H2,1-2H3,(H,15,20)(H,16,17,19)/t14-/m0/s1 |
| InChIKey | GUGIGNPAYVOXKM-AWEZNQCLSA-N |
| XLogP | 0.51 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |