C29H26N6O5 — CID 135889987
6-N-(4-methoxyphenyl)-5-methyl-3-N-(4-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide (PubChem CID 135889987) has the molecular formula C29H26N6O5 and a molecular weight of 538.56 g/mol. Its IUPAC name is 6-N-(4-methoxyphenyl)-5-methyl-3-N-(4-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide.
| Compound Name | 6-N-(4-methoxyphenyl)-5-methyl-3-N-(4-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 135889987 |
| Molecular Formula | C29H26N6O5 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 6-N-(4-methoxyphenyl)-5-methyl-3-N-(4-methylphenyl)-7-(3-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-3,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3c(C(=O)Nc4ccc(C)cc4)cnn3C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H26N6O5/c1-17-7-9-20(10-8-17)32-28(36)24-16-30-34-26(19-5-4-6-22(15-19)35(38)39)25(18(2)31-27(24)34)29(37)33-21-11-13-23(40-3)14-12-21/h4-16,26,31H,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | FNYDWJUVKLWRMT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|